C21H24N2O3 — CID 88907108
(2E,4E)-2-cyano-5-[2-(4-oxobutyl)-4-piperidin-1-ylphenyl]penta-2,4-dienoic acid (PubChem CID 88907108) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-[2-(4-oxobutyl)-4-piperidin-1-ylphenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-cyano-5-[2-(4-oxobutyl)-4-piperidin-1-ylphenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88907108 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (2E,4E)-2-cyano-5-[2-(4-oxobutyl)-4-piperidin-1-ylphenyl]penta-2,4-dienoic acid |
| SMILES | N#C/C(=C\C=C\c1ccc(N2CCCCC2)cc1CCCC=O)C(=O)O |
| InChI | InChI=1S/C21H24N2O3/c22-16-19(21(25)26)9-6-8-17-10-11-20(23-12-3-1-4-13-23)15-18(17)7-2-5-14-24/h6,8-11,14-15H,1-5,7,12-13H2,(H,25,26)/b8-6+,19-9+ |
| InChIKey | ZJFLJHXFPLJYPD-GRHJKWIASA-N |
| XLogP | 3.75 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|