C14H11N3O4 — CID 54053428
2-cyano-5-(2,4-diformamidophenyl)penta-2,4-dienoic acid (PubChem CID 54053428) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-cyano-5-(2,4-diformamidophenyl)penta-2,4-dienoic acid.
| Compound Name | 2-cyano-5-(2,4-diformamidophenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54053428 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-cyano-5-(2,4-diformamidophenyl)penta-2,4-dienoic acid |
| SMILES | N#CC(=CC=Cc1ccc(NC=O)cc1NC=O)C(=O)O |
| InChI | InChI=1S/C14H11N3O4/c15-7-11(14(20)21)3-1-2-10-4-5-12(16-8-18)6-13(10)17-9-19/h1-6,8-9H,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | LUNWBFLOELOCEQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|