C28H29N3O2 — CID 90838298
2-cyano-7,7-bis(4-pyrrolidin-1-ylphenyl)hepta-2,4,6-trienoic acid (PubChem CID 90838298) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-cyano-7,7-bis(4-pyrrolidin-1-ylphenyl)hepta-2,4,6-trienoic acid.
| Compound Name | 2-cyano-7,7-bis(4-pyrrolidin-1-ylphenyl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 90838298 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-cyano-7,7-bis(4-pyrrolidin-1-ylphenyl)hepta-2,4,6-trienoic acid |
| SMILES | N#CC(=CC=CC=C(c1ccc(N2CCCC2)cc1)c1ccc(N2CCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C28H29N3O2/c29-21-24(28(32)33)7-1-2-8-27(22-9-13-25(14-10-22)30-17-3-4-18-30)23-11-15-26(16-12-23)31-19-5-6-20-31/h1-2,7-16H,3-6,17-20H2,(H,32,33) |
| InChIKey | HTVMDCKNIUAVFQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|