C20H19FN2O3S — CID 88909810
4-fluoro-N-[(7R)-10-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]benzenesulfonamide (PubChem CID 88909810) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-fluoro-N-[(7R)-10-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(7R)-10-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 88909810 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 4-fluoro-N-[(7R)-10-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]benzenesulfonamide |
| SMILES | O=CCc1c2n(c3ccccc13)C[C@H](NS(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C20H19FN2O3S/c21-14-5-8-16(9-6-14)27(25,26)22-15-7-10-20-18(11-12-24)17-3-1-2-4-19(17)23(20)13-15/h1-6,8-9,12,15,22H,7,10-11,13H2/t15-/m1/s1 |
| InChIKey | NRZPXIFINQWLRO-OAHLLOKOSA-N |
| XLogP | 2.82 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|