C20H21FN2O2S — CID 90780240
N-(10-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl)-4-fluorobenzenesulfonamide (PubChem CID 90780240) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(10-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(10-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 90780240 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-(10-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl)-4-fluorobenzenesulfonamide |
| SMILES | CCc1c2n(c3ccccc13)CC(NS(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C20H21FN2O2S/c1-2-17-18-5-3-4-6-19(18)23-13-15(9-12-20(17)23)22-26(24,25)16-10-7-14(21)8-11-16/h3-8,10-11,15,22H,2,9,12-13H2,1H3 |
| InChIKey | AKUFLEZDFHJJCP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|