C11H16ClN3O4 — CID 88918882
ethyl 2-chloro-5-ethoxy-6-(2-hydroxyethylamino)pyrimidine-4-carboxylate (PubChem CID 88918882) has the molecular formula C11H16ClN3O4 and a molecular weight of 289.72 g/mol. Its IUPAC name is ethyl 2-chloro-5-ethoxy-6-(2-hydroxyethylamino)pyrimidine-4-carboxylate.
| Compound Name | ethyl 2-chloro-5-ethoxy-6-(2-hydroxyethylamino)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 88918882 |
| Molecular Formula | C11H16ClN3O4 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | ethyl 2-chloro-5-ethoxy-6-(2-hydroxyethylamino)pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(Cl)nc(NCCO)c1OCC |
| InChI | InChI=1S/C11H16ClN3O4/c1-3-18-8-7(10(17)19-4-2)14-11(12)15-9(8)13-5-6-16/h16H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | ZXSMFCNBCMRMSG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |