C15H12ClN3O3S — CID 88932679
N-[[5-(4-chloroquinazolin-6-yl)furan-2-yl]methyl]-2-sulfonylethanamine (PubChem CID 88932679) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is N-[[5-(4-chloroquinazolin-6-yl)furan-2-yl]methyl]-2-sulfonylethanamine.
| Compound Name | N-[[5-(4-chloroquinazolin-6-yl)furan-2-yl]methyl]-2-sulfonylethanamine |
|---|---|
| PubChem CID | 88932679 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[[5-(4-chloroquinazolin-6-yl)furan-2-yl]methyl]-2-sulfonylethanamine |
| SMILES | O=S(=O)=CCNCc1ccc(-c2ccc3ncnc(Cl)c3c2)o1 |
| InChI | InChI=1S/C15H12ClN3O3S/c16-15-12-7-10(1-3-13(12)18-9-19-15)14-4-2-11(22-14)8-17-5-6-23(20)21/h1-4,6-7,9,17H,5,8H2 |
| InChIKey | BCYSYQLTJSSHSI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|