C34H32F4N2O15S — CID 88934574
1-O-(5-acetyloxy-2,5-dimethylhexan-2-yl) 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate (PubChem CID 88934574) has the molecular formula C34H32F4N2O15S and a molecular weight of 816.69 g/mol. Its IUPAC name is 1-O-(5-acetyloxy-2,5-dimethylhexan-2-yl) 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate.
| Compound Name | 1-O-(5-acetyloxy-2,5-dimethylhexan-2-yl) 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate |
|---|---|
| PubChem CID | 88934574 |
| Molecular Formula | C34H32F4N2O15S |
| Molecular Weight | 816.69 g/mol |
| Exact Mass | 816.15 |
| IUPAC Name | 1-O-(5-acetyloxy-2,5-dimethylhexan-2-yl) 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate |
| SMILES | CC(=O)OC(C)(C)CCC(C)(C)OC(=O)CCC(=O)On1c(=O)c2cc3c(=O)n(OS(=O)(=O)c4c(F)c(F)c(OC(=O)C(C)C)c(F)c4F)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C34H32F4N2O15S/c1-14(2)32(48)51-26-22(35)24(37)27(25(38)23(26)36)56(49,50)55-40-30(46)18-12-16-17(13-19(18)31(40)47)29(45)39(28(16)44)54-21(43)9-8-20(42)53-34(6,7)11-10-33(4,5)52-15(3)41/h12-14H,8-11H2,1-7H3 |
| InChIKey | KJJBWWXNNQWTJP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 226.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|