C23H24N2O6 — CID 88937173
ethyl 3-[(2,4-dimethoxyphenyl)methylimino]-4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 88937173) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is ethyl 3-[(2,4-dimethoxyphenyl)methylimino]-4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | ethyl 3-[(2,4-dimethoxyphenyl)methylimino]-4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 88937173 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl 3-[(2,4-dimethoxyphenyl)methylimino]-4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CCOC(=O)C/C(CN1C(=O)c2ccccc2C1=O)=N\Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H24N2O6/c1-4-31-21(26)11-16(24-13-15-9-10-17(29-2)12-20(15)30-3)14-25-22(27)18-7-5-6-8-19(18)23(25)28/h5-10,12H,4,11,13-14H2,1-3H3/b24-16+ |
| InChIKey | ZBPPKOXODVVLBA-LFVJCYFKSA-N |
| XLogP | 2.89 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|