C25H23N3O8 — CID 58317531
ethyl 1-[(2,4-dimethoxyphenyl)methyl]-6-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dioxopyrimidine-5-carboxylate (PubChem CID 58317531) has the molecular formula C25H23N3O8 and a molecular weight of 493.47 g/mol. Its IUPAC name is ethyl 1-[(2,4-dimethoxyphenyl)methyl]-6-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dioxopyrimidine-5-carboxylate.
| Compound Name | ethyl 1-[(2,4-dimethoxyphenyl)methyl]-6-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dioxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 58317531 |
| Molecular Formula | C25H23N3O8 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | ethyl 1-[(2,4-dimethoxyphenyl)methyl]-6-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dioxopyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(CN2C(=O)c3ccccc3C2=O)n(Cc2ccc(OC)cc2OC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H23N3O8/c1-4-36-24(32)20-18(13-28-22(30)16-7-5-6-8-17(16)23(28)31)27(25(33)26-21(20)29)12-14-9-10-15(34-2)11-19(14)35-3/h5-11H,4,12-13H2,1-3H3,(H,26,29,33) |
| InChIKey | VQJINDIIOONYSF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|