C25H29BINO8 — CID 88947367
2,5,17-trihydroxy-15,19-dioxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4λ3-iodapentacyclo[9.8.0.03,5.04,9.013,18]nonadeca-1,6,8,16-tetraene-16-carboxamide (PubChem CID 88947367) has the molecular formula C25H29BINO8 and a molecular weight of 609.22 g/mol. Its IUPAC name is 2,5,17-trihydroxy-15,19-dioxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4λ3-iodapentacyclo[9.8.0.03,5.04,9.013,18]nonadeca-1,6,8,16-tetraene-16-carboxamide.
| Compound Name | 2,5,17-trihydroxy-15,19-dioxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4λ3-iodapentacyclo[9.8.0.03,5.04,9.013,18]nonadeca-1,6,8,16-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 88947367 |
| Molecular Formula | C25H29BINO8 |
| Molecular Weight | 609.22 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | 2,5,17-trihydroxy-15,19-dioxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4λ3-iodapentacyclo[9.8.0.03,5.04,9.013,18]nonadeca-1,6,8,16-tetraene-16-carboxamide |
| SMILES | CC1(C)OB(C2=C3CC4CC5CC(=O)C(C(N)=O)=C(O)C5C(=O)C4=C(O)C4I3C4(O)C=C2)OC1(C)C |
| InChI | InChI=1S/C25H29BINO8/c1-23(2)24(3,4)36-26(35-23)12-5-6-25(34)21-20(32)16-10(8-13(12)27(21)25)7-11-9-14(29)17(22(28)33)19(31)15(11)18(16)30/h5-6,10-11,15,21,31-32,34H,7-9H2,1-4H3,(H2,28,33) |
| InChIKey | RUIOYHDFYGCRCM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|