C19H19NO6 — CID 70804528
(4aS,5aR)-1,11,12-trihydroxy-3,10-dioxo-4,4a,5,5a,6,8,9,12a-octahydrotetracene-2-carboxamide (PubChem CID 70804528) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is (4aS,5aR)-1,11,12-trihydroxy-3,10-dioxo-4,4a,5,5a,6,8,9,12a-octahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR)-1,11,12-trihydroxy-3,10-dioxo-4,4a,5,5a,6,8,9,12a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70804528 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (4aS,5aR)-1,11,12-trihydroxy-3,10-dioxo-4,4a,5,5a,6,8,9,12a-octahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2C(O)=C3C(O)=C4C(=O)CCC=C4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C19H19NO6/c20-19(26)15-11(22)6-9-5-8-4-7-2-1-3-10(21)12(7)16(23)13(8)17(24)14(9)18(15)25/h2,8-9,14,23-25H,1,3-6H2,(H2,20,26)/t8-,9-,14?/m0/s1 |
| InChIKey | KDYOVPYMQSBFBL-SURUFBRLSA-N |
| XLogP | 1.83 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|