C21H30BrNO6S2 — CID 88950772
5-O-[2-(oxan-2-yloxy)ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 4-bromo-2,2-dimethylpentanedioate (PubChem CID 88950772) has the molecular formula C21H30BrNO6S2 and a molecular weight of 536.51 g/mol. Its IUPAC name is 5-O-[2-(oxan-2-yloxy)ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 4-bromo-2,2-dimethylpentanedioate.
| Compound Name | 5-O-[2-(oxan-2-yloxy)ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 4-bromo-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 88950772 |
| Molecular Formula | C21H30BrNO6S2 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 5-O-[2-(oxan-2-yloxy)ethyl] 1-O-[2-(pyridin-2-yldisulfanyl)ethyl] 4-bromo-2,2-dimethylpentanedioate |
| SMILES | CC(C)(CC(Br)C(=O)OCCOC1CCCCO1)C(=O)OCCSSc1ccccn1 |
| InChI | InChI=1S/C21H30BrNO6S2/c1-21(2,20(25)29-13-14-30-31-17-7-3-5-9-23-17)15-16(22)19(24)28-12-11-27-18-8-4-6-10-26-18/h3,5,7,9,16,18H,4,6,8,10-15H2,1-2H3 |
| InChIKey | QVHSPJIKGNLKTL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|