C14H18N2O6S — CID 88950995
phenyl (NE)-N-[amino-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethylidene]carbamate (PubChem CID 88950995) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is phenyl (NE)-N-[amino-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethylidene]carbamate.
| Compound Name | phenyl (NE)-N-[amino-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethylidene]carbamate |
|---|---|
| PubChem CID | 88950995 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | phenyl (NE)-N-[amino-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethylidene]carbamate |
| SMILES | N/C(=N\C(=O)Oc1ccccc1)S[C@@H]1C[C@@H](O)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C14H18N2O6S/c15-13(16-14(20)21-8-4-2-1-3-5-8)23-11-6-9(18)12(19)10(7-17)22-11/h1-5,9-12,17-19H,6-7H2,(H2,15,16,20)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | VVKPCIROBQBJGT-KKOKHZNYSA-N |
| XLogP | 0.06 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|