C20H38O6S — CID 88965503
1-O-(2-ethylhexyl) 4-O-heptan-3-yl 2-methylsulfonylbutanedioate (PubChem CID 88965503) has the molecular formula C20H38O6S and a molecular weight of 406.59 g/mol. Its IUPAC name is 1-O-(2-ethylhexyl) 4-O-heptan-3-yl 2-methylsulfonylbutanedioate.
| Compound Name | 1-O-(2-ethylhexyl) 4-O-heptan-3-yl 2-methylsulfonylbutanedioate |
|---|---|
| PubChem CID | 88965503 |
| Molecular Formula | C20H38O6S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-O-(2-ethylhexyl) 4-O-heptan-3-yl 2-methylsulfonylbutanedioate |
| SMILES | CCCCC(CC)COC(=O)C(CC(=O)OC(CC)CCCC)S(C)(=O)=O |
| InChI | InChI=1S/C20H38O6S/c1-6-10-12-16(8-3)15-25-20(22)18(27(5,23)24)14-19(21)26-17(9-4)13-11-7-2/h16-18H,6-15H2,1-5H3 |
| InChIKey | SYPAADODIHDDSM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |