C32H33F3O — CID 89002374
2-[2-(difluoromethyl)-3-fluoro-5-methyl-4-[2-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]ethyl]phenyl]oxirane (PubChem CID 89002374) has the molecular formula C32H33F3O and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-3-fluoro-5-methyl-4-[2-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]ethyl]phenyl]oxirane.
| Compound Name | 2-[2-(difluoromethyl)-3-fluoro-5-methyl-4-[2-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]ethyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89002374 |
| Molecular Formula | C32H33F3O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-[2-(difluoromethyl)-3-fluoro-5-methyl-4-[2-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]ethyl]phenyl]oxirane |
| SMILES | C=CCC/C=C/CCc1ccc(-c2ccc(CCc3c(C)cc(C4CO4)c(C(F)F)c3F)cc2)cc1 |
| InChI | InChI=1S/C32H33F3O/c1-3-4-5-6-7-8-9-23-10-15-25(16-11-23)26-17-12-24(13-18-26)14-19-27-22(2)20-28(29-21-36-29)30(31(27)33)32(34)35/h3,6-7,10-13,15-18,20,29,32H,1,4-5,8-9,14,19,21H2,2H3/b7-6+ |
| InChIKey | YBNJHEYLZVPKBN-VOTSOKGWSA-N |
| XLogP | 9.05 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|