C22H25NO4S — CID 89013987
1-(4-methylphenyl)sulfonyl-4-(4-oxobutyl)-3,5-dihydro-2H-1-benzazepine-4-carbaldehyde (PubChem CID 89013987) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-(4-oxobutyl)-3,5-dihydro-2H-1-benzazepine-4-carbaldehyde.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-(4-oxobutyl)-3,5-dihydro-2H-1-benzazepine-4-carbaldehyde |
|---|---|
| PubChem CID | 89013987 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-(4-oxobutyl)-3,5-dihydro-2H-1-benzazepine-4-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C=O)(CCCC=O)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-18-8-10-20(11-9-18)28(26,27)23-14-13-22(17-25,12-4-5-15-24)16-19-6-2-3-7-21(19)23/h2-3,6-11,15,17H,4-5,12-14,16H2,1H3 |
| InChIKey | GYSKXIUULAZFHB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|