C13H14F2N2O3 — CID 89018593
(4-nitrosophenyl) N-(4,4-difluorocyclohexyl)carbamate (PubChem CID 89018593) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is (4-nitrosophenyl) N-(4,4-difluorocyclohexyl)carbamate.
| Compound Name | (4-nitrosophenyl) N-(4,4-difluorocyclohexyl)carbamate |
|---|---|
| PubChem CID | 89018593 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4-nitrosophenyl) N-(4,4-difluorocyclohexyl)carbamate |
| SMILES | O=Nc1ccc(OC(=O)NC2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C13H14F2N2O3/c14-13(15)7-5-9(6-8-13)16-12(18)20-11-3-1-10(17-19)2-4-11/h1-4,9H,5-8H2,(H,16,18) |
| InChIKey | WCKDUYCSEFXNBB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |