C9H13NO3 — CID 89044140
2-oxopropyl 2-(buta-1,3-dien-2-ylamino)acetate (PubChem CID 89044140) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-oxopropyl 2-(buta-1,3-dien-2-ylamino)acetate.
| Compound Name | 2-oxopropyl 2-(buta-1,3-dien-2-ylamino)acetate |
|---|---|
| PubChem CID | 89044140 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2-oxopropyl 2-(buta-1,3-dien-2-ylamino)acetate |
| SMILES | C=CC(=C)NCC(=O)OCC(C)=O |
| InChI | InChI=1S/C9H13NO3/c1-4-7(2)10-5-9(12)13-6-8(3)11/h4,10H,1-2,5-6H2,3H3 |
| InChIKey | QZJNJYFYQXLIKR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|