C5H5F3N2O6S3 — CID 89050021
2-(acetylsulfamoyl)-2-sulfanylidene-N-(trifluoromethylsulfonyl)acetamide (PubChem CID 89050021) has the molecular formula C5H5F3N2O6S3 and a molecular weight of 342.30 g/mol. Its IUPAC name is 2-(acetylsulfamoyl)-2-sulfanylidene-N-(trifluoromethylsulfonyl)acetamide.
| Compound Name | 2-(acetylsulfamoyl)-2-sulfanylidene-N-(trifluoromethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 89050021 |
| Molecular Formula | C5H5F3N2O6S3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 2-(acetylsulfamoyl)-2-sulfanylidene-N-(trifluoromethylsulfonyl)acetamide |
| SMILES | CC(=O)NS(=O)(=O)C(=S)C(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H5F3N2O6S3/c1-2(11)9-18(13,14)4(17)3(12)10-19(15,16)5(6,7)8/h1H3,(H,9,11)(H,10,12) |
| InChIKey | KDDDZHSRHHFOJR-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|