C34H37FN4OS — CID 89053998
5-[(2-fluorophenyl)methyl]-2-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]-4-sulfanylidene-3a,9b-dihydro-1H-cyclopenta[c]quinoline-7-carboxamide (PubChem CID 89053998) has the molecular formula C34H37FN4OS and a molecular weight of 568.76 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-2-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]-4-sulfanylidene-3a,9b-dihydro-1H-cyclopenta[c]quinoline-7-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methyl]-2-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]-4-sulfanylidene-3a,9b-dihydro-1H-cyclopenta[c]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 89053998 |
| Molecular Formula | C34H37FN4OS |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-2-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]-4-sulfanylidene-3a,9b-dihydro-1H-cyclopenta[c]quinoline-7-carboxamide |
| SMILES | CC1=CC2C(=S)N(Cc3ccccc3F)c3cc(C(=O)NCCCN4CCN(c5ccccc5)CC4)ccc3C2C1 |
| InChI | InChI=1S/C34H37FN4OS/c1-24-20-29-28-13-12-25(22-32(28)39(34(41)30(29)21-24)23-26-8-5-6-11-31(26)35)33(40)36-14-7-15-37-16-18-38(19-17-37)27-9-3-2-4-10-27/h2-6,8-13,21-22,29-30H,7,14-20,23H2,1H3,(H,36,40) |
| InChIKey | MHGOCBHOCHULPB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|