C27H30O9S — CID 89055092
[2-[1-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propyl] 9-oxothioxanthene-2-carboxylate (PubChem CID 89055092) has the molecular formula C27H30O9S and a molecular weight of 530.60 g/mol. Its IUPAC name is [2-[1-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propyl] 9-oxothioxanthene-2-carboxylate.
| Compound Name | [2-[1-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propyl] 9-oxothioxanthene-2-carboxylate |
|---|---|
| PubChem CID | 89055092 |
| Molecular Formula | C27H30O9S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | [2-[1-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-(2-methylprop-2-enoyloxy)propyl] 9-oxothioxanthene-2-carboxylate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)c1ccc2sc3ccccc3c(=O)c2c1)OC(C)OCCOCCO |
| InChI | InChI=1S/C27H30O9S/c1-17(2)26(30)34-15-20(36-18(3)33-13-12-32-11-10-28)16-35-27(31)19-8-9-24-22(14-19)25(29)21-6-4-5-7-23(21)37-24/h4-9,14,18,20,28H,1,10-13,15-16H2,2-3H3 |
| InChIKey | XUZQPZLZOPIOJF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|