C16H19F3O6S — CID 89076848
(5,6,8-trimethoxy-4,7-dimethyl-3,4-dihydronaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 89076848) has the molecular formula C16H19F3O6S and a molecular weight of 396.38 g/mol. Its IUPAC name is (5,6,8-trimethoxy-4,7-dimethyl-3,4-dihydronaphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | (5,6,8-trimethoxy-4,7-dimethyl-3,4-dihydronaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89076848 |
| Molecular Formula | C16H19F3O6S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (5,6,8-trimethoxy-4,7-dimethyl-3,4-dihydronaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | COc1c(C)c(OC)c(OC)c2c1C=C(OS(=O)(=O)C(F)(F)F)CC2C |
| InChI | InChI=1S/C16H19F3O6S/c1-8-6-10(25-26(20,21)16(17,18)19)7-11-12(8)15(24-5)14(23-4)9(2)13(11)22-3/h7-8H,6H2,1-5H3 |
| InChIKey | UBTYZTGVNHWOHN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|