C17H28N2 — CID 89110438
(1Z)-3-tert-butyl-1-N'-methyl-1-N'-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]penta-1,4-diene-1,1-diamine (PubChem CID 89110438) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (1Z)-3-tert-butyl-1-N'-methyl-1-N'-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]penta-1,4-diene-1,1-diamine.
| Compound Name | (1Z)-3-tert-butyl-1-N'-methyl-1-N'-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]penta-1,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 89110438 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (1Z)-3-tert-butyl-1-N'-methyl-1-N'-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]penta-1,4-diene-1,1-diamine |
| SMILES | C=C/C(C)=C\C=C\N(C)/C(N)=C\C(C=C)C(C)(C)C |
| InChI | InChI=1S/C17H28N2/c1-8-14(3)11-10-12-19(7)16(18)13-15(9-2)17(4,5)6/h8-13,15H,1-2,18H2,3-7H3/b12-10+,14-11-,16-13- |
| InChIKey | RRGIFLOPRYVMSX-KMWQVDMFSA-N |
| XLogP | 4.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|