C21H20F2IN3OS — CID 89115090
3-[3-(ethylsulfanylamino)-2-methylphenoxy]-5-fluoro-1-N-(2-fluoro-4-iodophenyl)benzene-1,2-diamine (PubChem CID 89115090) has the molecular formula C21H20F2IN3OS and a molecular weight of 527.38 g/mol. Its IUPAC name is 3-[3-(ethylsulfanylamino)-2-methylphenoxy]-5-fluoro-1-N-(2-fluoro-4-iodophenyl)benzene-1,2-diamine.
| Compound Name | 3-[3-(ethylsulfanylamino)-2-methylphenoxy]-5-fluoro-1-N-(2-fluoro-4-iodophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 89115090 |
| Molecular Formula | C21H20F2IN3OS |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 3-[3-(ethylsulfanylamino)-2-methylphenoxy]-5-fluoro-1-N-(2-fluoro-4-iodophenyl)benzene-1,2-diamine |
| SMILES | CCSNc1cccc(Oc2cc(F)cc(Nc3ccc(I)cc3F)c2N)c1C |
| InChI | InChI=1S/C21H20F2IN3OS/c1-3-29-27-16-5-4-6-19(12(16)2)28-20-10-13(22)9-18(21(20)25)26-17-8-7-14(24)11-15(17)23/h4-11,26-27H,3,25H2,1-2H3 |
| InChIKey | QUVNEYIPJPGSRH-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|