C31H32OSi — CID 89117238
2-anthra[1,2-b][1]benzofuran-9-ylethynyl-tri(propan-2-yl)silane (PubChem CID 89117238) has the molecular formula C31H32OSi and a molecular weight of 448.68 g/mol. Its IUPAC name is 2-anthra[1,2-b][1]benzofuran-9-ylethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-anthra[1,2-b][1]benzofuran-9-ylethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 89117238 |
| Molecular Formula | C31H32OSi |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-anthra[1,2-b][1]benzofuran-9-ylethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1ccc2oc3c4cc5ccccc5cc4ccc3c2c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H32OSi/c1-20(2)33(21(3)4,22(5)6)16-15-23-11-14-30-29(17-23)27-13-12-26-18-24-9-7-8-10-25(24)19-28(26)31(27)32-30/h7-14,17-22H,1-6H3 |
| InChIKey | BKTDOTSLCRHGHG-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|