C23H19N3O4 — CID 89130864
4-(1-benzofuran-2-ylmethylamino)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 89130864) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-(1-benzofuran-2-ylmethylamino)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-(1-benzofuran-2-ylmethylamino)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 89130864 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-(1-benzofuran-2-ylmethylamino)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3cccc(NCc4cc5ccccc5o4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19N3O4/c1-13-9-10-18(21(27)25-13)26-22(28)16-6-4-7-17(20(16)23(26)29)24-12-15-11-14-5-2-3-8-19(14)30-15/h2-8,11,18,24H,1,9-10,12H2,(H,25,27) |
| InChIKey | YOAPELUFWJFCBF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|