C14H25BrO3 — CID 89163078
(E,2R,6S)-8-[(1R,2R,3R,5R)-3-bromo-5-hydroxy-2-methylcyclopentyl]oct-7-ene-2,6-diol (PubChem CID 89163078) has the molecular formula C14H25BrO3 and a molecular weight of 321.26 g/mol. Its IUPAC name is (E,2R,6S)-8-[(1R,2R,3R,5R)-3-bromo-5-hydroxy-2-methylcyclopentyl]oct-7-ene-2,6-diol.
| Compound Name | (E,2R,6S)-8-[(1R,2R,3R,5R)-3-bromo-5-hydroxy-2-methylcyclopentyl]oct-7-ene-2,6-diol |
|---|---|
| PubChem CID | 89163078 |
| Molecular Formula | C14H25BrO3 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (E,2R,6S)-8-[(1R,2R,3R,5R)-3-bromo-5-hydroxy-2-methylcyclopentyl]oct-7-ene-2,6-diol |
| SMILES | C[C@@H]1[C@@H](/C=C/[C@@H](O)CCC[C@@H](C)O)[C@H](O)C[C@H]1Br |
| InChI | InChI=1S/C14H25BrO3/c1-9(16)4-3-5-11(17)6-7-12-10(2)13(15)8-14(12)18/h6-7,9-14,16-18H,3-5,8H2,1-2H3/b7-6+/t9-,10-,11+,12-,13-,14-/m1/s1 |
| InChIKey | LMSZRLRKBZXTRL-PMMXORBQSA-N |
| XLogP | 2.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|