C8H8N2OS2 — CID 89204534
N-(3-sulfanylbuta-1,3-dien-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 89204534) has the molecular formula C8H8N2OS2 and a molecular weight of 212.30 g/mol. Its IUPAC name is N-(3-sulfanylbuta-1,3-dien-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-sulfanylbuta-1,3-dien-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89204534 |
| Molecular Formula | C8H8N2OS2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | N-(3-sulfanylbuta-1,3-dien-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C=C(S)C(=C)NC(=O)c1cscn1 |
| InChI | InChI=1S/C8H8N2OS2/c1-5(6(2)12)10-8(11)7-3-13-4-9-7/h3-4,12H,1-2H2,(H,10,11) |
| InChIKey | CLWRJSUJGWQVKD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|