C23H33N3O5S — CID 89236996
benzyl 4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxylate (PubChem CID 89236996) has the molecular formula C23H33N3O5S and a molecular weight of 463.60 g/mol. Its IUPAC name is benzyl 4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 89236996 |
| Molecular Formula | C23H33N3O5S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | benzyl 4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxylate |
| SMILES | C=CC(=O)NC1C(C)CN(S(=O)(=O)C2CCN(C(=O)OCc3ccccc3)CC2)CC1C |
| InChI | InChI=1S/C23H33N3O5S/c1-4-21(27)24-22-17(2)14-26(15-18(22)3)32(29,30)20-10-12-25(13-11-20)23(28)31-16-19-8-6-5-7-9-19/h4-9,17-18,20,22H,1,10-16H2,2-3H3,(H,24,27) |
| InChIKey | DGCUEBFKHFVUKR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|