About 2-(iodoamino)propanal
2-(iodoamino)propanal (PubChem CID 89241681) has the molecular formula C3H6INO
and a molecular weight of 198.99 g/mol. Its IUPAC name is 2-(iodoamino)propanal.
Molecular Properties
| Compound Name | 2-(iodoamino)propanal |
| PubChem CID | 89241681 |
| Molecular Formula | C3H6INO |
| Molecular Weight | 198.99 g/mol |
| Exact Mass | 198.95 |
| IUPAC Name | 2-(iodoamino)propanal |
| SMILES | CC(C=O)NI |
| InChI | InChI=1S/C3H6INO/c1-3(2-6)5-4/h2-3,5H,1H3 |
| InChIKey | ZLKNLTQBSBOBAJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.99 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodoamino)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodoamino)propanal?
The IUPAC name of 2-(iodoamino)propanal (CID 89241681) is 2-(iodoamino)propanal.
What is the SMILES notation for 2-(iodoamino)propanal?
The canonical SMILES for 2-(iodoamino)propanal is CC(C=O)NI.
What is the InChIKey of 2-(iodoamino)propanal?
The InChIKey is ZLKNLTQBSBOBAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6INO/c1-3(2-6)5-4/h2-3,5H,1H3.
What are the key properties of 2-(iodoamino)propanal?
2-(iodoamino)propanal has a molecular weight of 198.99 g/mol, XLogP of 0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodoamino)propanal is sourced from PubChem (CID 89241681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).