C29H30NO10P — CID 89241766
6-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-3,4-dihydroxanthene]-5-carbonyl)amino]hexyl ethenyl hydrogen phosphate (PubChem CID 89241766) has the molecular formula C29H30NO10P and a molecular weight of 583.53 g/mol. Its IUPAC name is 6-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-3,4-dihydroxanthene]-5-carbonyl)amino]hexyl ethenyl hydrogen phosphate.
| Compound Name | 6-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-3,4-dihydroxanthene]-5-carbonyl)amino]hexyl ethenyl hydrogen phosphate |
|---|---|
| PubChem CID | 89241766 |
| Molecular Formula | C29H30NO10P |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 6-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-3,4-dihydroxanthene]-5-carbonyl)amino]hexyl ethenyl hydrogen phosphate |
| SMILES | C=COP(=O)(O)OCCCCCCNC(=O)c1ccc2c(c1)C1(OC2=O)C2=C(CC(O)C=C2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C29H30NO10P/c1-2-37-41(35,36)38-14-6-4-3-5-13-30-27(33)18-7-10-21-24(15-18)29(40-28(21)34)22-11-8-19(31)16-25(22)39-26-17-20(32)9-12-23(26)29/h2,7-12,15-16,20,31-32H,1,3-6,13-14,17H2,(H,30,33)(H,35,36) |
| InChIKey | TZTFOFIPKSHDHM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|