C39H42N2O9 — CID 89259689
dibenzyl (2S)-2-[[(2S)-1-benzylperoxy-5-oxo-5-phenylmethoxypentan-2-yl]carbamoylamino]pentanedioate (PubChem CID 89259689) has the molecular formula C39H42N2O9 and a molecular weight of 682.77 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[(2S)-1-benzylperoxy-5-oxo-5-phenylmethoxypentan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[(2S)-1-benzylperoxy-5-oxo-5-phenylmethoxypentan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 89259689 |
| Molecular Formula | C39H42N2O9 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | dibenzyl (2S)-2-[[(2S)-1-benzylperoxy-5-oxo-5-phenylmethoxypentan-2-yl]carbamoylamino]pentanedioate |
| SMILES | O=C(N[C@@H](CCC(=O)OCc1ccccc1)COOCc1ccccc1)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H42N2O9/c42-36(46-25-30-13-5-1-6-14-30)23-21-34(29-50-49-28-33-19-11-4-12-20-33)40-39(45)41-35(38(44)48-27-32-17-9-3-10-18-32)22-24-37(43)47-26-31-15-7-2-8-16-31/h1-20,34-35H,21-29H2,(H2,40,41,45)/t34-,35-/m0/s1 |
| InChIKey | PNVSBDMNUZSAQS-PXLJZGITSA-N |
| XLogP | 5.96 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|