C37H42N2O9 — CID 89259732
dibenzyl (2S)-2-[[[[(2S)-1,4-bis(benzylperoxy)butan-2-yl]amino]-hydroxymethyl]amino]butanedioate (PubChem CID 89259732) has the molecular formula C37H42N2O9 and a molecular weight of 658.75 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[[[(2S)-1,4-bis(benzylperoxy)butan-2-yl]amino]-hydroxymethyl]amino]butanedioate.
| Compound Name | dibenzyl (2S)-2-[[[[(2S)-1,4-bis(benzylperoxy)butan-2-yl]amino]-hydroxymethyl]amino]butanedioate |
|---|---|
| PubChem CID | 89259732 |
| Molecular Formula | C37H42N2O9 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | dibenzyl (2S)-2-[[[[(2S)-1,4-bis(benzylperoxy)butan-2-yl]amino]-hydroxymethyl]amino]butanedioate |
| SMILES | O=C(C[C@H](NC(O)N[C@@H](CCOOCc1ccccc1)COOCc1ccccc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C37H42N2O9/c40-35(43-24-29-13-5-1-6-14-29)23-34(36(41)44-25-30-15-7-2-8-16-30)39-37(42)38-33(28-48-47-27-32-19-11-4-12-20-32)21-22-45-46-26-31-17-9-3-10-18-31/h1-20,33-34,37-39,42H,21-28H2/t33-,34-,37?/m0/s1 |
| InChIKey | KJOLSDPDUYWVJQ-JWTXWEFBSA-N |
| XLogP | 4.74 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|