C37H53NO5Si — CID 89296254
tert-butyl 2-[(4E)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxyimino-6-[3-(2-methylpropyl)cyclobutyl]hex-5-yn-3-yl]oxyacetate (PubChem CID 89296254) has the molecular formula C37H53NO5Si and a molecular weight of 619.92 g/mol. Its IUPAC name is tert-butyl 2-[(4E)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxyimino-6-[3-(2-methylpropyl)cyclobutyl]hex-5-yn-3-yl]oxyacetate.
| Compound Name | tert-butyl 2-[(4E)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxyimino-6-[3-(2-methylpropyl)cyclobutyl]hex-5-yn-3-yl]oxyacetate |
|---|---|
| PubChem CID | 89296254 |
| Molecular Formula | C37H53NO5Si |
| Molecular Weight | 619.92 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | tert-butyl 2-[(4E)-1-[tert-butyl(diphenyl)silyl]oxy-4-methoxyimino-6-[3-(2-methylpropyl)cyclobutyl]hex-5-yn-3-yl]oxyacetate |
| SMILES | CO/N=C(\C#CC1CC(CC(C)C)C1)C(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H53NO5Si/c1-28(2)24-30-25-29(26-30)20-21-33(38-40-9)34(41-27-35(39)43-36(3,4)5)22-23-42-44(37(6,7)8,31-16-12-10-13-17-31)32-18-14-11-15-19-32/h10-19,28-30,34H,22-27H2,1-9H3/b38-33+ |
| InChIKey | RINKJIFTMIRQND-NNIBMBRCSA-N |
| XLogP | 6.76 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.92 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|