C39H56O4Si — CID 71127387
tert-butyl 3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-6-[3-(2-methylpropyl)cyclobutyl]-4-oxohex-5-ynoate (PubChem CID 71127387) has the molecular formula C39H56O4Si and a molecular weight of 616.96 g/mol. Its IUPAC name is tert-butyl 3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-6-[3-(2-methylpropyl)cyclobutyl]-4-oxohex-5-ynoate.
| Compound Name | tert-butyl 3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-6-[3-(2-methylpropyl)cyclobutyl]-4-oxohex-5-ynoate |
|---|---|
| PubChem CID | 71127387 |
| Molecular Formula | C39H56O4Si |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.39 |
| IUPAC Name | tert-butyl 3-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-6-[3-(2-methylpropyl)cyclobutyl]-4-oxohex-5-ynoate |
| SMILES | CC(C)CC1CC(C#CC(=O)C(CC(=O)OC(C)(C)C)CC(C)(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C39H56O4Si/c1-29(2)23-31-24-30(25-31)21-22-35(40)32(26-36(41)43-37(3,4)5)27-39(9,10)28-42-44(38(6,7)8,33-17-13-11-14-18-33)34-19-15-12-16-20-34/h11-20,29-32H,23-28H2,1-10H3 |
| InChIKey | XLPGYBUEQIKHMN-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|