C17H19F4NO7S — CID 89297237
1,1,2,2-tetrafluoro-6-[[3-(2-methylprop-2-enoyloxy)phenyl]carbamoyloxy]hexane-1-sulfonic acid (PubChem CID 89297237) has the molecular formula C17H19F4NO7S and a molecular weight of 457.40 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[[3-(2-methylprop-2-enoyloxy)phenyl]carbamoyloxy]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-6-[[3-(2-methylprop-2-enoyloxy)phenyl]carbamoyloxy]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 89297237 |
| Molecular Formula | C17H19F4NO7S |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[[3-(2-methylprop-2-enoyloxy)phenyl]carbamoyloxy]hexane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)Oc1cccc(NC(=O)OCCCCC(F)(F)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H19F4NO7S/c1-11(2)14(23)29-13-7-5-6-12(10-13)22-15(24)28-9-4-3-8-16(18,19)17(20,21)30(25,26)27/h5-7,10H,1,3-4,8-9H2,2H3,(H,22,24)(H,25,26,27) |
| InChIKey | SRUAYWGNHPZBDI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|