C25H30N2O5 — CID 89309863
N-(2-cyclopropylethoxy)-N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 89309863) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is N-(2-cyclopropylethoxy)-N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-(2-cyclopropylethoxy)-N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 89309863 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-(2-cyclopropylethoxy)-N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(/C(=O)NCCO)N(OCCC2CC2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H30N2O5/c1-2-31-22-12-10-20(11-13-22)18-23(24(29)26-15-16-28)27(32-17-14-19-8-9-19)25(30)21-6-4-3-5-7-21/h3-7,10-13,18-19,28H,2,8-9,14-17H2,1H3,(H,26,29)/b23-18- |
| InChIKey | BYKDVZWTFSNNQG-NKFKGCMQSA-N |
| XLogP | 3.41 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|