C22H25BrO2 — CID 89328190
[2-bromoethoxy-cyclohexa-1,3-dien-1-yl-[(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl]benzene (PubChem CID 89328190) has the molecular formula C22H25BrO2 and a molecular weight of 401.34 g/mol. Its IUPAC name is [2-bromoethoxy-cyclohexa-1,3-dien-1-yl-[(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl]benzene.
| Compound Name | [2-bromoethoxy-cyclohexa-1,3-dien-1-yl-[(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl]benzene |
|---|---|
| PubChem CID | 89328190 |
| Molecular Formula | C22H25BrO2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [2-bromoethoxy-cyclohexa-1,3-dien-1-yl-[(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl]benzene |
| SMILES | CO[C@@H]1C=CC(C(OCCBr)(C2=CC=CCC2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C22H25BrO2/c1-24-21-14-12-20(13-15-21)22(25-17-16-23,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-6,8-10,12-14,21H,7,11,15-17H2,1H3/t21-,22?/m1/s1 |
| InChIKey | GTJUFCUZCJVXRI-ZMFCMNQTSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|