C4F9IO2S — CID 89346717
1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane-1-sulfonyl iodide (PubChem CID 89346717) has the molecular formula C4F9IO2S and a molecular weight of 410.00 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane-1-sulfonyl iodide.
| Compound Name | 1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane-1-sulfonyl iodide |
|---|---|
| PubChem CID | 89346717 |
| Molecular Formula | C4F9IO2S |
| Molecular Weight | 410.00 g/mol |
| Exact Mass | 409.85 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane-1-sulfonyl iodide |
| SMILES | O=S(=O)(I)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4F9IO2S/c5-1(2(6,7)8,3(9,10)11)4(12,13)17(14,15)16 |
| InChIKey | OZZBIGXDRWORBA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.00 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|