C6H8F4N2O8S2 — CID 89370395
2-[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethylamino]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 89370395) has the molecular formula C6H8F4N2O8S2 and a molecular weight of 376.26 g/mol. Its IUPAC name is 2-[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethylamino]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethylamino]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89370395 |
| Molecular Formula | C6H8F4N2O8S2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2-[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethylamino]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(NCCNC(=O)C(F)(F)S(=O)(=O)O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C6H8F4N2O8S2/c7-5(8,21(15,16)17)3(13)11-1-2-12-4(14)6(9,10)22(18,19)20/h1-2H2,(H,11,13)(H,12,14)(H,15,16,17)(H,18,19,20) |
| InChIKey | PYIVELJGJIGZRD-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|