C13H20F6N2O2S — CID 89375376
1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)-4-piperidin-1-ylpiperidine (PubChem CID 89375376) has the molecular formula C13H20F6N2O2S and a molecular weight of 382.37 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)-4-piperidin-1-ylpiperidine.
| Compound Name | 1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 89375376 |
| Molecular Formula | C13H20F6N2O2S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)-4-piperidin-1-ylpiperidine |
| SMILES | O=S(=O)(N1CCC(N2CCCCC2)CC1)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H20F6N2O2S/c14-11(15)12(16,17)13(18,19)24(22,23)21-8-4-10(5-9-21)20-6-2-1-3-7-20/h10-11H,1-9H2 |
| InChIKey | RXGGFUBBYREXFE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|