C33H32BrN3O2 — CID 89390729
[6-bromo-3-[4-(dimethylamino)-2-hydroxy-2-(naphthalen-1-ylmethyl)-1-phenylbutyl]quinolin-2-yl] methanimidate (PubChem CID 89390729) has the molecular formula C33H32BrN3O2 and a molecular weight of 582.54 g/mol. Its IUPAC name is [6-bromo-3-[4-(dimethylamino)-2-hydroxy-2-(naphthalen-1-ylmethyl)-1-phenylbutyl]quinolin-2-yl] methanimidate.
| Compound Name | [6-bromo-3-[4-(dimethylamino)-2-hydroxy-2-(naphthalen-1-ylmethyl)-1-phenylbutyl]quinolin-2-yl] methanimidate |
|---|---|
| PubChem CID | 89390729 |
| Molecular Formula | C33H32BrN3O2 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | [6-bromo-3-[4-(dimethylamino)-2-hydroxy-2-(naphthalen-1-ylmethyl)-1-phenylbutyl]quinolin-2-yl] methanimidate |
| SMILES | [H]/N=C/Oc1nc2ccc(Br)cc2cc1C(c1ccccc1)C(O)(CCN(C)C)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C33H32BrN3O2/c1-37(2)18-17-33(38,21-25-13-8-12-23-9-6-7-14-28(23)25)31(24-10-4-3-5-11-24)29-20-26-19-27(34)15-16-30(26)36-32(29)39-22-35/h3-16,19-20,22,31,35,38H,17-18,21H2,1-2H3/b35-22+ |
| InChIKey | NBBHZEBWQKYFSS-FADJLKOXSA-N |
| XLogP | 7.19 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|