C21H20N4O2S — CID 89427127
5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-6-(3-hydroxyphenyl)-3,4-dimethyl-1,6-dihydropyrimidin-2-one (PubChem CID 89427127) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-6-(3-hydroxyphenyl)-3,4-dimethyl-1,6-dihydropyrimidin-2-one.
| Compound Name | 5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-6-(3-hydroxyphenyl)-3,4-dimethyl-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 89427127 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-6-(3-hydroxyphenyl)-3,4-dimethyl-1,6-dihydropyrimidin-2-one |
| SMILES | CC1=C(c2nc(-c3cccc(N)c3)cs2)C(c2cccc(O)c2)NC(=O)N1C |
| InChI | InChI=1S/C21H20N4O2S/c1-12-18(20-23-17(11-28-20)13-5-3-7-15(22)9-13)19(24-21(27)25(12)2)14-6-4-8-16(26)10-14/h3-11,19,26H,22H2,1-2H3,(H,24,27) |
| InChIKey | DYKXEZXBVXKBSP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|