C9H9NO2 — CID 89427789
4-methoxy-4H-1,2-benzoxazine (PubChem CID 89427789) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-methoxy-4H-1,2-benzoxazine.
| Compound Name | 4-methoxy-4H-1,2-benzoxazine |
|---|---|
| PubChem CID | 89427789 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 4-methoxy-4H-1,2-benzoxazine |
| SMILES | COC1C=NOc2ccccc21 |
| InChI | InChI=1S/C9H9NO2/c1-11-9-6-10-12-8-5-3-2-4-7(8)9/h2-6,9H,1H3 |
| InChIKey | MAWJOOCIZNPBGE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |