C21H36O2 — CID 89487006
[6,10-dimethyl-4-(2-methylprop-1-enyl)dodeca-6,10-dien-2-yl] propanoate (PubChem CID 89487006) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is [6,10-dimethyl-4-(2-methylprop-1-enyl)dodeca-6,10-dien-2-yl] propanoate.
| Compound Name | [6,10-dimethyl-4-(2-methylprop-1-enyl)dodeca-6,10-dien-2-yl] propanoate |
|---|---|
| PubChem CID | 89487006 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | [6,10-dimethyl-4-(2-methylprop-1-enyl)dodeca-6,10-dien-2-yl] propanoate |
| SMILES | CC=C(C)CCC=C(C)CC(C=C(C)C)CC(C)OC(=O)CC |
| InChI | InChI=1S/C21H36O2/c1-8-17(5)11-10-12-18(6)14-20(13-16(3)4)15-19(7)23-21(22)9-2/h8,12-13,19-20H,9-11,14-15H2,1-7H3 |
| InChIKey | QNGFRLCFPWOZQT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|