C17H10Cl2IN7O2 — CID 90030130
5-[1-(3,4-dichlorophenyl)-3-iodopyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole (PubChem CID 90030130) has the molecular formula C17H10Cl2IN7O2 and a molecular weight of 542.12 g/mol. Its IUPAC name is 5-[1-(3,4-dichlorophenyl)-3-iodopyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole.
| Compound Name | 5-[1-(3,4-dichlorophenyl)-3-iodopyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 90030130 |
| Molecular Formula | C17H10Cl2IN7O2 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 540.93 |
| IUPAC Name | 5-[1-(3,4-dichlorophenyl)-3-iodopyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole |
| SMILES | O=[N+]([O-])c1ccc(Cn2nnc(-c3cn(-c4ccc(Cl)c(Cl)c4)nc3I)n2)cc1 |
| InChI | InChI=1S/C17H10Cl2IN7O2/c18-14-6-5-12(7-15(14)19)25-9-13(16(20)22-25)17-21-24-26(23-17)8-10-1-3-11(4-2-10)27(28)29/h1-7,9H,8H2 |
| InChIKey | UFXCEHACDSUDKW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|