C16H22O3 — CID 90047967
methyl (E)-2-(2,4-diethyl-6-methylphenyl)-3-hydroxybut-2-enoate (PubChem CID 90047967) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (E)-2-(2,4-diethyl-6-methylphenyl)-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(2,4-diethyl-6-methylphenyl)-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 90047967 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (E)-2-(2,4-diethyl-6-methylphenyl)-3-hydroxybut-2-enoate |
| SMILES | CCc1cc(C)c(/C(C(=O)OC)=C(/C)O)c(CC)c1 |
| InChI | InChI=1S/C16H22O3/c1-6-12-8-10(3)14(13(7-2)9-12)15(11(4)17)16(18)19-5/h8-9,17H,6-7H2,1-5H3/b15-11+ |
| InChIKey | RWGUETIVEGRNRZ-RVDMUPIBSA-N |
| XLogP | 3.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|