C21H20N4O — CID 90058663
(9R,11E)-12-methyl-3,7,14,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(21),2(24),4,11,15(23),16,18(22),19-octaen-6-one (PubChem CID 90058663) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is (9R,11E)-12-methyl-3,7,14,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(21),2(24),4,11,15(23),16,18(22),19-octaen-6-one.
| Compound Name | (9R,11E)-12-methyl-3,7,14,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(21),2(24),4,11,15(23),16,18(22),19-octaen-6-one |
|---|---|
| PubChem CID | 90058663 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (9R,11E)-12-methyl-3,7,14,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(21),2(24),4,11,15(23),16,18(22),19-octaen-6-one |
| SMILES | C/C1=C/C[C@@H]2CNC(=O)c3cc([nH]c32)-c2cccc3ccc(nc23)NC1 |
| InChI | InChI=1S/C21H20N4O/c1-12-5-6-14-11-23-21(26)16-9-17(24-20(14)16)15-4-2-3-13-7-8-18(22-10-12)25-19(13)15/h2-5,7-9,14,24H,6,10-11H2,1H3,(H,22,25)(H,23,26)/b12-5-/t14-/m1/s1 |
| InChIKey | OCXHQNSXWKMTQQ-WTKLMOFPSA-N |
| XLogP | 3.82 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|