C20H22IN3O6 — CID 90102638
tert-butyl N-[4-[(E)-2-(4-iodo-2-methoxy-3-pyridinyl)ethenyl]-2-methoxy-5-nitrophenyl]carbamate (PubChem CID 90102638) has the molecular formula C20H22IN3O6 and a molecular weight of 527.32 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-2-(4-iodo-2-methoxy-3-pyridinyl)ethenyl]-2-methoxy-5-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(E)-2-(4-iodo-2-methoxy-3-pyridinyl)ethenyl]-2-methoxy-5-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 90102638 |
| Molecular Formula | C20H22IN3O6 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | tert-butyl N-[4-[(E)-2-(4-iodo-2-methoxy-3-pyridinyl)ethenyl]-2-methoxy-5-nitrophenyl]carbamate |
| SMILES | COc1cc(/C=C/c2c(I)ccnc2OC)c([N+](=O)[O-])cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22IN3O6/c1-20(2,3)30-19(25)23-15-11-16(24(26)27)12(10-17(15)28-4)6-7-13-14(21)8-9-22-18(13)29-5/h6-11H,1-5H3,(H,23,25)/b7-6+ |
| InChIKey | XPNXDEPEDVEOKY-VOTSOKGWSA-N |
| XLogP | 5.13 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|